
CAS 1219971-98-8
:Piperidine, 2-[2-[(2,4-dichlorophenyl)methoxy]ethyl]-, hydrochloride (1:1)
Description:
Piperidine, 2-[2-[(2,4-dichlorophenyl)methoxy]ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated nitrogen-containing heterocycle. The compound features a 2,4-dichlorophenyl group, indicating the presence of two chlorine substituents on the phenyl ring, which can influence its biological activity and lipophilicity. The methoxyethyl side chain contributes to the compound's overall structure and may affect its solubility and interaction with biological targets. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The presence of the hydrochloride indicates that the compound is likely to be used in a medicinal context, potentially as a drug or a precursor in drug synthesis. Its specific properties, such as melting point, boiling point, and reactivity, would depend on the interactions of its functional groups and the overall molecular structure. Safety and handling precautions should be observed due to the presence of chlorine substituents, which can pose environmental and health risks.
Formula:C14H19Cl2NO·ClH
InChI:InChI=1S/C14H19Cl2NO.ClH/c15-12-5-4-11(14(16)9-12)10-18-8-6-13-3-1-2-7-17-13;/h4-5,9,13,17H,1-3,6-8,10H2;1H
InChI key:InChIKey=XABPFQMGBWJNNM-UHFFFAOYSA-N
SMILES:C(OCCC1CCCCN1)C2=C(Cl)C=C(Cl)C=C2.Cl
Synonyms:- Piperidine, 2-[2-[(2,4-dichlorophenyl)methoxy]ethyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.