CAS 1219972-03-8

1-(6-Chloro-2-pyridinyl)-3-pyrrolidinol

Description:

1-(6-Chloro-2-pyridinyl)-3-pyrrolidinol, identified by its CAS number 1219972-03-8, is a chemical compound that features a pyridine ring substituted with a chlorine atom and a pyrrolidine moiety. This compound is characterized by its heterocyclic structure, which includes both nitrogen-containing rings, contributing to its potential biological activity. The presence of the chloro substituent on the pyridine ring can influence the compound's reactivity and interaction with biological targets. Typically, compounds of this nature may exhibit properties such as solubility in organic solvents and varying degrees of polarity, depending on the functional groups present. The pyrrolidinol part of the molecule may impart characteristics associated with alcohols, such as hydrogen bonding capabilities. Overall, this compound may be of interest in medicinal chemistry and pharmacology, particularly in the development of therapeutic agents, due to its unique structural features and potential biological activities. However, specific applications and effects would require further investigation through experimental studies.

Formula: C₉H₁₁ClN₂O

InChI: InChI=1S/C9H11ClN2O/c10-8-2-1-3-9(11-8)12-5-4-7(13)6-12/h1-3,7,13H,4-6H2

InChI key: InChIKey=LPHWEYJVBHTFQX-UHFFFAOYSA-N

SMILES: ClC1=NC(=CC=C1)N2CCC(O)C2

Synonyms:

• 1-(6-Chloro-2-pyridinyl)-3-pyrrolidinol
• 3-Pyrrolidinol, 1-(6-chloro-2-pyridinyl)-