CAS 1219972-06-1

Piperidine, 4-[2-[4-(trifluoromethyl)phenoxy]ethyl]-, hydrochloride (1:1)

Description:

Piperidine, 4-[2-[4-(trifluoromethyl)phenoxy]ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic amine. The presence of a trifluoromethyl group on the phenoxy moiety enhances its lipophilicity and may influence its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. This compound may exhibit properties such as moderate to high polarity due to the presence of both the piperidine and phenoxy groups, and it may participate in hydrogen bonding due to the nitrogen atom in the piperidine ring. Its trifluoromethyl group can also impart unique electronic properties, potentially affecting its reactivity and interaction with biological targets. Overall, this compound is of interest in medicinal chemistry and may be explored for its potential therapeutic applications, although specific biological activities would require further investigation.

Formula: C₁₄H₁₈F₃NO·ClH

InChI: InChI=1S/C14H18F3NO.ClH/c15-14(16,17)12-1-3-13(4-2-12)19-10-7-11-5-8-18-9-6-11;/h1-4,11,18H,5-10H2;1H

InChI key: InChIKey=RRLMZAMZYZKKPT-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=CC=C(OCCC2CCNCC2)C=C1.Cl

Synonyms:

• Piperidine, 4-[2-[4-(trifluoromethyl)phenoxy]ethyl]-, hydrochloride (1:1)