CAS 1219972-41-4

Benzoic acid, 2-(3-pyrrolidinyloxy)-, methyl ester, hydrochloride (1:1)

Description:

Benzoic acid, 2-(3-pyrrolidinyloxy)-, methyl ester, hydrochloride (1:1) is a chemical compound characterized by its ester functional group and the presence of a pyrrolidine ring. This compound typically exhibits properties associated with both benzoic acid derivatives and pyrrolidine-based structures, which may influence its solubility, stability, and reactivity. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, enhancing its bioavailability in pharmaceutical applications. The presence of the pyrrolidinyloxy group suggests potential interactions with biological systems, possibly affecting its pharmacological activity. This compound may be utilized in various research contexts, particularly in medicinal chemistry, due to its structural features that could contribute to specific biological activities. Safety and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards associated with its use.

Formula: C₁₂H₁₅NO₃·ClH

InChI: InChI=1S/C12H15NO3.ClH/c1-15-12(14)10-4-2-3-5-11(10)16-9-6-7-13-8-9;/h2-5,9,13H,6-8H2,1H3;1H

InChI key: InChIKey=DTQMGQLAELSJMI-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C(OC2CCNC2)C=CC=C1.Cl

Synonyms:

• Benzoic acid, 2-(3-pyrrolidinyloxy)-, methyl ester, hydrochloride (1:1)

Methyl 2-(3-pyrrolidinyloxy)benzoate hydrochloride

CAS: 1219972-41-4

Versatile small molecule scaffold

Formula: C₁₂H₁₆ClNO₃

Purity: Min. 95%

Molecular weight: 257.71 g/mol

Ref: 3D-UYB97241