
CAS 1219972-44-7
:Piperidine, 3-[(2,4,5-trichlorophenoxy)methyl]-, hydrochloride (1:1)
Description:
Piperidine, 3-[(2,4,5-trichlorophenoxy)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The presence of the 2,4,5-trichlorophenoxy group indicates that the compound has significant chlorinated aromatic characteristics, which can influence its biological activity and chemical reactivity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The compound may exhibit properties such as being a potential intermediate in organic synthesis or having specific pharmacological effects due to the piperidine structure, which is often associated with various biological activities. Safety data sheets would provide information on handling, toxicity, and environmental impact, which are crucial for laboratory and industrial applications. Overall, this compound's unique structure and properties make it of interest in both research and practical applications in chemistry and related fields.
Formula:C12H14Cl3NO·ClH
InChI:InChI=1S/C12H14Cl3NO.ClH/c13-9-4-11(15)12(5-10(9)14)17-7-8-2-1-3-16-6-8;/h4-5,8,16H,1-3,6-7H2;1H
InChI key:InChIKey=GJEBTEUHFWAIKB-UHFFFAOYSA-N
SMILES:O(CC1CCCNC1)C2=C(Cl)C=C(Cl)C(Cl)=C2.Cl
Synonyms:- Piperidine, 3-[(2,4,5-trichlorophenoxy)methyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.