CymitQuimica logo

CAS 1219972-45-8

:

Pyrrolidine, 3-[2-bromo-4-(1-methylpropyl)phenoxy]-, hydrochloride (1:1)

Description:
Pyrrolidine, 3-[2-bromo-4-(1-methylpropyl)phenoxy]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered saturated heterocycle containing one nitrogen atom. The compound features a phenoxy group substituted with a bromine atom and a branched alkyl chain, specifically 1-methylpropyl, which contributes to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its potential applications in various fields, including pharmaceuticals. The presence of the bromine atom may impart specific reactivity and biological activity, making it of interest in medicinal chemistry. The compound's molecular interactions, stability, and potential biological effects would depend on its specific structure and substituents. Safety and handling precautions should be observed, as with all chemical substances, particularly those with halogenated groups, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and applications.
Formula:C14H20BrNO·ClH
InChI:InChI=1S/C14H20BrNO.ClH/c1-3-10(2)11-4-5-14(13(15)8-11)17-12-6-7-16-9-12;/h4-5,8,10,12,16H,3,6-7,9H2,1-2H3;1H
InChI key:InChIKey=IYHSKNXNRGCPBU-UHFFFAOYSA-N
SMILES:O(C1=C(Br)C=C(C(CC)C)C=C1)C2CCNC2.Cl
Synonyms:
  • Pyrrolidine, 3-[2-bromo-4-(1-methylpropyl)phenoxy]-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.