CAS 1219972-66-3

3-Piperidinemethanol, 3-benzoate, hydrochloride (1:1)

Description:

3-Piperidinemethanol, 3-benzoate, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features a benzoate group, indicating the presence of a benzene ring attached to a carboxylate moiety, which contributes to its aromatic properties. The hydrochloride form suggests that the compound is a salt, formed by the reaction of the base (the piperidinemethanol) with hydrochloric acid, enhancing its solubility in water and stability. Typically, such compounds may exhibit biological activity, potentially serving as intermediates in pharmaceutical synthesis or as active pharmaceutical ingredients. The presence of both the piperidine and benzoate functionalities may influence its pharmacokinetic properties, such as absorption and distribution. Additionally, the hydrochloride salt form often improves the compound's handling and formulation characteristics in drug development. As with many organic compounds, safety data and handling precautions should be considered, particularly regarding its potential toxicity and reactivity.

Formula: C₁₃H₁₇NO₂·ClH

InChI: InChI=1S/C13H17NO2.ClH/c15-13(12-6-2-1-3-7-12)16-10-11-5-4-8-14-9-11;/h1-3,6-7,11,14H,4-5,8-10H2;1H

InChI key: InChIKey=OAHVRRMYXNIWGL-UHFFFAOYSA-N

SMILES: C(OCC1CCCNC1)(=O)C2=CC=CC=C2.Cl

Synonyms:

• 3-Piperidinemethanol, 3-benzoate, hydrochloride (1:1)