CAS 1219972-70-9

3-Piperidinecarboxamide, N-methyl-N-[(tetrahydro-2H-pyran-4-yl)methyl]-, hydrochloride (1:1)

Description:

3-Piperidinecarboxamide, N-methyl-N-[(tetrahydro-2H-pyran-4-yl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine and tetrahydropyran moieties, which contribute to its structural complexity and potential biological activity. The presence of the piperidine ring suggests that it may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds. The N-methyl substitution indicates that the compound may have altered steric and electronic properties compared to its non-methylated counterparts. The hydrochloride salt form enhances its solubility in water, making it more suitable for pharmaceutical applications. This compound may be of interest in medicinal chemistry due to its potential interactions with biological targets, possibly influencing neurotransmitter systems or other physiological pathways. Its specific applications and efficacy would depend on further research, including pharmacological studies and toxicity assessments. Overall, the compound's unique structure and properties position it as a candidate for further investigation in drug development.

Formula: C₁₃H₂₄N₂O₂·ClH

InChI: InChI=1S/C13H24N2O2.ClH/c1-15(10-11-4-7-17-8-5-11)13(16)12-3-2-6-14-9-12;/h11-12,14H,2-10H2,1H3;1H

InChI key: InChIKey=QZSGMCSJEAQELP-UHFFFAOYSA-N

SMILES: C(N(CC1CCOCC1)C)(=O)C2CCCNC2.Cl

Synonyms:

• 3-Piperidinecarboxamide, N-methyl-N-[(tetrahydro-2H-pyran-4-yl)methyl]-, hydrochloride (1:1)