
CAS 1219976-16-5
:Benzoic acid, 2-(3-piperidinyloxy)-, methyl ester, hydrochloride (1:1)
Description:
Benzoic acid, 2-(3-piperidinyloxy)-, methyl ester, hydrochloride (1:1) is a chemical compound characterized by its ester functional group and the presence of a piperidine ring, which contributes to its pharmacological properties. The compound features a benzoic acid moiety, indicating it has aromatic characteristics, and the methyl ester group enhances its lipophilicity, potentially affecting its solubility and bioavailability. The hydrochloride form suggests that it is a salt, which often improves stability and solubility in aqueous solutions. This compound may exhibit biological activity, possibly acting as a pharmaceutical agent, due to the presence of the piperidine structure, which is commonly found in various drugs. Its molecular interactions can be influenced by the functional groups present, making it of interest in medicinal chemistry. As with many compounds, safety and handling precautions should be observed, particularly in laboratory settings, due to potential toxicity or reactivity. Further studies would be necessary to elucidate its specific applications and mechanisms of action.
Formula:C13H17NO3·ClH
InChI:InChI=1S/C13H17NO3.ClH/c1-16-13(15)11-6-2-3-7-12(11)17-10-5-4-8-14-9-10;/h2-3,6-7,10,14H,4-5,8-9H2,1H3;1H
InChI key:InChIKey=TVLSSUSVSYLLHU-UHFFFAOYSA-N
SMILES:O(C1=C(C(OC)=O)C=CC=C1)C2CCCNC2.Cl
Synonyms:- Benzoic acid, 2-(3-piperidinyloxy)-, methyl ester, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.