CymitQuimica logo

CAS 1219976-18-7

:

Piperidine, 4-[[4-(1,1-dimethylpropyl)phenoxy]methyl]-, hydrochloride (1:1)

Description:
Piperidine, 4-[[4-(1,1-dimethylpropyl)phenoxy]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. This compound features a phenoxy group substituted with a tert-butyl group, contributing to its lipophilicity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The presence of the piperidine moiety suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure indicates that it may exhibit properties such as basicity due to the nitrogen atom in the piperidine ring, and it may participate in hydrogen bonding due to the presence of functional groups. Safety and handling precautions should be observed, as with all chemical substances, particularly in laboratory settings. Further studies would be necessary to elucidate its specific pharmacological effects and potential applications.
Formula:C17H27NO·ClH
InChI:InChI=1S/C17H27NO.ClH/c1-4-17(2,3)15-5-7-16(8-6-15)19-13-14-9-11-18-12-10-14;/h5-8,14,18H,4,9-13H2,1-3H3;1H
InChI key:InChIKey=BXTUAZSDQYSVEX-UHFFFAOYSA-N
SMILES:C(CC)(C)(C)C1=CC=C(OCC2CCNCC2)C=C1.Cl
Synonyms:
  • Piperidine, 4-[[4-(1,1-dimethylpropyl)phenoxy]methyl]-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.