CymitQuimica logo

CAS 1219976-28-9

:

3-(4-Bromo-2-ethylphenoxy)azetidine

Description:
3-(4-Bromo-2-ethylphenoxy)azetidine is a chemical compound characterized by its azetidine ring, which is a four-membered saturated heterocyclic structure containing one nitrogen atom. The compound features a phenoxy group, specifically a 4-bromo-2-ethylphenyl moiety, which contributes to its unique properties. The presence of the bromine atom introduces a halogen, potentially enhancing the compound's reactivity and influencing its biological activity. The ethyl group on the phenyl ring can affect the steric and electronic properties, impacting how the molecule interacts with biological targets or other chemical species. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its specific applications and behavior would depend on further studies, including its solubility, stability, and reactivity under various conditions. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or environmental impact.
Formula:C11H14BrNO
InChI:InChI=1S/C11H14BrNO/c1-2-8-5-9(12)3-4-11(8)14-10-6-13-7-10/h3-5,10,13H,2,6-7H2,1H3
InChI key:InChIKey=LFDZZENQUAZZMF-UHFFFAOYSA-N
SMILES:O(C1=C(CC)C=C(Br)C=C1)C2CNC2
Synonyms:
  • 3-(4-Bromo-2-ethylphenoxy)azetidine
  • Azetidine, 3-(4-bromo-2-ethylphenoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.