CymitQuimica logo

CAS 1219976-31-4

:

Pyrrolidine, 3-(4-bromo-2-nitrophenoxy)-, hydrochloride (1:1)

Description:
Pyrrolidine, 3-(4-bromo-2-nitrophenoxy)-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered saturated heterocycle containing one nitrogen atom. The presence of a 4-bromo-2-nitrophenoxy group indicates that the compound has a bromine atom and a nitro group attached to a phenoxy moiety, contributing to its potential reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its utility in various applications, including pharmaceuticals. The compound may exhibit specific pharmacological properties due to the functional groups present, making it of interest in medicinal chemistry. Its molecular interactions can be influenced by the electron-withdrawing nature of the nitro group and the halogen substituent, which may affect its lipophilicity and overall biological profile. Safety and handling precautions should be observed, as with all chemical substances, particularly those with halogen and nitro functionalities, which can pose health risks.
Formula:C10H11BrN2O3·ClH
InChI:InChI=1S/C10H11BrN2O3.ClH/c11-7-1-2-10(9(5-7)13(14)15)16-8-3-4-12-6-8;/h1-2,5,8,12H,3-4,6H2;1H
InChI key:InChIKey=DCWPCXPXDCAQDN-UHFFFAOYSA-N
SMILES:O(C1=C(N(=O)=O)C=C(Br)C=C1)C2CCNC2.Cl
Synonyms:
  • Pyrrolidine, 3-(4-bromo-2-nitrophenoxy)-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.