
CAS 1219976-33-6
:Methanone, (3-hydroxy-1-pyrrolidinyl)(4,5,6,7-tetrahydro-1H-pyrazolo[4,3-c]pyridin-3-yl)-, hydrochloride (1:1)
Description:
Methanone, (3-hydroxy-1-pyrrolidinyl)(4,5,6,7-tetrahydro-1H-pyrazolo[4,3-c]pyridin-3-yl)-, hydrochloride (1:1), identified by CAS number 1219976-33-6, is a chemical compound characterized by its complex structure, which includes a pyrrolidine and a tetrahydro-pyrazolo-pyridine moiety. This substance is typically encountered as a hydrochloride salt, enhancing its solubility in aqueous environments. The presence of the hydroxyl group contributes to its potential reactivity and interaction with biological systems. The compound may exhibit pharmacological properties, making it of interest in medicinal chemistry and drug development. Its specific characteristics, such as melting point, solubility, and stability, can vary based on the formulation and conditions. As with many organic compounds, it is essential to handle this substance with care, adhering to safety protocols due to potential biological activity. Further studies and analyses are necessary to fully elucidate its properties and potential applications in various fields, including pharmaceuticals and biochemistry.
Formula:C11H16N4O2·ClH
InChI:InChI=1S/C11H16N4O2.ClH/c16-7-2-4-15(6-7)11(17)10-8-5-12-3-1-9(8)13-14-10;/h7,12,16H,1-6H2,(H,13,14);1H
InChI key:InChIKey=WXKRQSVSRNZTNO-UHFFFAOYSA-N
SMILES:C(=O)(C=1C2=C(NN1)CCNC2)N3CC(O)CC3.Cl
Synonyms:- Methanone, (3-hydroxy-1-pyrrolidinyl)(4,5,6,7-tetrahydro-1H-pyrazolo[4,3-c]pyridin-3-yl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.