CymitQuimica logo

CAS 1219976-43-8

:

Piperidine, 4-[2-[2-(2-propen-1-yl)phenoxy]ethyl]-, hydrochloride (1:1)

Description:
Piperidine, 4-[2-[2-(2-propen-1-yl)phenoxy]ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. This compound features a phenoxy group attached to a 2-(2-propen-1-yl) substituent, indicating the presence of an allyl group that contributes to its reactivity and potential biological activity. The hydrochloride form suggests that it is a salt, enhancing its solubility in water and making it suitable for various applications, including pharmaceutical formulations. The presence of the piperidine moiety often correlates with properties such as analgesic, anti-inflammatory, or central nervous system activity. Its molecular structure allows for interactions with biological targets, making it of interest in medicinal chemistry. As with many piperidine derivatives, it may exhibit diverse pharmacological effects, but specific biological activities would depend on further empirical studies. Safety and handling precautions should be observed due to potential toxicity associated with piperidine derivatives.
Formula:C16H23NO·ClH
InChI:InChI=1S/C16H23NO.ClH/c1-2-5-15-6-3-4-7-16(15)18-13-10-14-8-11-17-12-9-14;/h2-4,6-7,14,17H,1,5,8-13H2;1H
InChI key:InChIKey=BADXMQRZWGCSBQ-UHFFFAOYSA-N
SMILES:O(CCC1CCNCC1)C2=C(CC=C)C=CC=C2.Cl
Synonyms:
  • Piperidine, 4-[2-[2-(2-propen-1-yl)phenoxy]ethyl]-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.