CAS 1219976-48-3

Piperidine, 3-(2-iodophenoxy)-, hydrochloride (1:1)

Description:

Piperidine, 3-(2-iodophenoxy)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a 2-iodophenoxy group indicates that the compound has a phenolic structure substituted with iodine, contributing to its unique reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals and organic synthesis. The compound may exhibit properties such as being a potential ligand or intermediate in drug development, particularly in the context of medicinal chemistry. Its molecular structure suggests it could interact with biological targets, making it of interest for further research. Safety and handling precautions should be observed, as with many halogenated compounds, due to potential toxicity and environmental impact. Overall, this compound represents a specific class of organic molecules with diverse applications in chemical research and development.

Formula: C₁₁H₁₄INO·ClH

InChI: InChI=1S/C11H14INO.ClH/c12-10-5-1-2-6-11(10)14-9-4-3-7-13-8-9;/h1-2,5-6,9,13H,3-4,7-8H2;1H

InChI key: InChIKey=AHRYQWLGVGTOER-UHFFFAOYSA-N

SMILES: O(C1=C(I)C=CC=C1)C2CCCNC2.Cl

Synonyms:

• Piperidine, 3-(2-iodophenoxy)-, hydrochloride (1:1)