
CAS 1219976-49-4
:Piperidine, 3-[2-(3-bromophenoxy)ethyl]-, hydrochloride (1:1)
Description:
Piperidine, 3-[2-(3-bromophenoxy)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The compound features a 3-substituted ethyl group that includes a 3-bromophenoxy moiety, contributing to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The presence of the bromophenoxy group may impart specific interactions with biological targets, making it of interest in medicinal chemistry. The compound's molecular structure suggests potential uses in drug development, particularly in the synthesis of compounds with neuroactive properties. Safety and handling precautions should be observed due to the presence of bromine, which can be hazardous. Overall, this compound exemplifies the complexity and diversity of piperidine derivatives in chemical research and development.
Formula:C13H18BrNO·ClH
InChI:InChI=1S/C13H18BrNO.ClH/c14-12-4-1-5-13(9-12)16-8-6-11-3-2-7-15-10-11;/h1,4-5,9,11,15H,2-3,6-8,10H2;1H
InChI key:InChIKey=DGWWSOPSGBGYSK-UHFFFAOYSA-N
SMILES:O(CCC1CCCNC1)C2=CC(Br)=CC=C2.Cl
Synonyms:- Piperidine, 3-[2-(3-bromophenoxy)ethyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.