CAS 1219976-54-1

Piperidine, 3-[(2-iodophenoxy)methyl]-, hydrochloride (1:1)

Description:

Piperidine, 3-[(2-iodophenoxy)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. The compound features a 2-iodophenoxy group attached to the piperidine at the 3-position, contributing to its unique properties and potential biological activity. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and facilitates its use in various applications, including pharmaceuticals and organic synthesis. The presence of the iodine atom may impart specific reactivity and influence the compound's interaction with biological targets. Piperidine derivatives are often studied for their roles in medicinal chemistry, particularly in the development of drugs targeting neurological and psychiatric disorders. Safety and handling considerations are essential, as with many chemical substances, due to potential toxicity and reactivity. Proper laboratory protocols should be followed when working with this compound to ensure safe usage.

Formula: C₁₂H₁₆INO·ClH

InChI: InChI=1S/C12H16INO.ClH/c13-11-5-1-2-6-12(11)15-9-10-4-3-7-14-8-10;/h1-2,5-6,10,14H,3-4,7-9H2;1H

InChI key: InChIKey=OYFHNKYHRNECNY-UHFFFAOYSA-N

SMILES: O(CC1CCCNC1)C2=C(I)C=CC=C2.Cl

Synonyms:

• Piperidine, 3-[(2-iodophenoxy)methyl]-, hydrochloride (1:1)