CAS 1219976-55-2

Pyrrolidine, 3-[[(2,4-difluorophenyl)methoxy]methyl]-, hydrochloride (1:1)

Description:

Pyrrolidine, 3-[[(2,4-difluorophenyl)methoxy]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered saturated nitrogen-containing heterocycle. The presence of the 2,4-difluorophenyl group indicates that the compound has two fluorine atoms substituted on a phenyl ring, which can influence its electronic properties and biological activity. The methoxy group attached to the phenyl ring enhances its solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for pharmaceutical applications. This compound may exhibit various biological activities, potentially acting as a pharmacological agent, but specific effects would depend on its interaction with biological targets. Its molecular structure suggests potential uses in medicinal chemistry, particularly in the development of drugs targeting neurological or psychiatric conditions, although further research would be necessary to elucidate its specific properties and applications.

Formula: C₁₂H₁₅F₂NO·ClH

InChI: InChI=1S/C12H15F2NO.ClH/c13-11-2-1-10(12(14)5-11)8-16-7-9-3-4-15-6-9;/h1-2,5,9,15H,3-4,6-8H2;1H

InChI key: InChIKey=FDCBOJZEADHRIA-UHFFFAOYSA-N

SMILES: C(OCC1CCNC1)C2=C(F)C=C(F)C=C2.Cl

Synonyms:

• Pyrrolidine, 3-[[(2,4-difluorophenyl)methoxy]methyl]-, hydrochloride (1:1)