CymitQuimica logo

CAS 1219976-56-3

:

3-(Cyclopropylmethoxy)azetidine

Description:
3-(Cyclopropylmethoxy)azetidine is a chemical compound characterized by its azetidine ring, which is a four-membered saturated heterocyclic structure containing one nitrogen atom. The presence of a cyclopropylmethoxy group introduces unique steric and electronic properties, influencing the compound's reactivity and potential applications. This compound may exhibit interesting pharmacological activities due to its structural features, making it a subject of interest in medicinal chemistry. The cyclopropyl group can enhance the lipophilicity and metabolic stability of the molecule, while the methoxy group can participate in hydrogen bonding and affect solubility. As with many azetidine derivatives, the compound may be synthesized through various organic reactions, including nucleophilic substitutions or cyclization processes. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the presence of functional groups. Overall, 3-(Cyclopropylmethoxy)azetidine represents a versatile scaffold for further chemical modifications and potential therapeutic applications.
Formula:C7H13NO
InChI:InChI=1S/C7H13NO/c1-2-6(1)5-9-7-3-8-4-7/h6-8H,1-5H2
InChI key:InChIKey=YNIGCEJFTCIFBV-UHFFFAOYSA-N
SMILES:O(CC1CC1)C2CNC2
Synonyms:
  • Azetidine, 3-(cyclopropylmethoxy)-
  • 3-(Cyclopropylmethoxy)azetidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.