CAS 1219976-58-5

N-(5-Bromo-3-methyl-2-pyridinyl)-4-pyridinemethanamine

Description:

N-(5-Bromo-3-methyl-2-pyridinyl)-4-pyridinemethanamine, identified by its CAS number 1219976-58-5, is a chemical compound characterized by its complex structure, which includes multiple pyridine rings and a bromine substituent. This compound features a bromine atom at the 5-position of a 3-methyl-2-pyridine moiety, which contributes to its unique reactivity and potential biological activity. The presence of the amine group allows for hydrogen bonding and may influence its solubility and interaction with biological targets. Typically, compounds of this nature are studied for their potential pharmacological properties, including antimicrobial or anticancer activities. The molecular structure suggests that it may exhibit lipophilicity, which can affect its absorption and distribution in biological systems. Additionally, the bromine atom can enhance the compound's reactivity, making it a candidate for further chemical modifications or as a lead compound in drug discovery. Overall, this substance represents a class of heterocyclic compounds with significant interest in medicinal chemistry.

Formula: C₁₂H₁₂BrN₃

InChI: InChI=1S/C12H12BrN3/c1-9-6-11(13)8-16-12(9)15-7-10-2-4-14-5-3-10/h2-6,8H,7H2,1H3,(H,15,16)

InChI key: InChIKey=DYHBHOPMGXWPQR-UHFFFAOYSA-N

SMILES: N(CC=1C=CN=CC1)C2=C(C)C=C(Br)C=N2

Synonyms:

• 4-Pyridinemethanamine, N-(5-bromo-3-methyl-2-pyridinyl)-
• N-(5-Bromo-3-methyl-2-pyridinyl)-4-pyridinemethanamine