
CAS 1219976-61-0
:Benzoic acid, 4-(3-piperidinyloxy)-, phenylmethyl ester, hydrochloride (1:1)
Description:
Benzoic acid, 4-(3-piperidinyloxy)-, phenylmethyl ester, hydrochloride (1:1) is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety, a piperidine derivative, and a phenylmethyl ester. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the hydrochloride salt form. The piperidine ring contributes to its potential biological activity, making it of interest in medicinal chemistry, particularly for its possible pharmacological properties. The hydrochloride form enhances its stability and solubility, which is advantageous for formulation in pharmaceutical applications. Additionally, the compound may exhibit specific interactions with biological targets, making it a candidate for further research in drug development. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity and reactivity. Overall, this compound represents a unique combination of functional groups that may lend itself to various applications in research and industry.
Formula:C19H21NO3.ClH
InChI:InChI=1S/C19H21NO3.ClH/c21-19(22-14-15-5-2-1-3-6-15)16-8-10-17(11-9-16)23-18-7-4-12-20-13-18;/h1-3,5-6,8-11,18,20H,4,7,12-14H2;1H
InChI key:InChIKey=BAFGZQNPVUHALZ-UHFFFAOYSA-N
SMILES:O(C1=CC=C(C(OCC2=CC=CC=C2)=O)C=C1)C3CCCNC3.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.