CAS 1219976-66-5
:3-Chloro-N-(4-fluorophenyl)-5-(trifluoromethyl)-2-pyridinamine
Description:
3-Chloro-N-(4-fluorophenyl)-5-(trifluoromethyl)-2-pyridinamine is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with various functional groups. The presence of a chloro group and a trifluoromethyl group contributes to its unique reactivity and potential applications in medicinal chemistry. The fluorine atoms enhance the lipophilicity and metabolic stability of the compound, making it of interest in drug design. This compound may exhibit biological activity due to its ability to interact with specific biological targets, potentially serving as a lead compound in the development of pharmaceuticals. Its molecular structure suggests it may participate in hydrogen bonding and other intermolecular interactions, influencing its solubility and bioavailability. Additionally, the presence of multiple halogen atoms can affect the compound's electronic properties, potentially leading to interesting pharmacological profiles. As with many synthetic organic compounds, safety and handling precautions are essential due to potential toxicity and environmental impact.
Formula:C12H7ClF4N2
InChI:InChI=1S/C12H7ClF4N2/c13-10-5-7(12(15,16)17)6-18-11(10)19-9-3-1-8(14)2-4-9/h1-6H,(H,18,19)
InChI key:InChIKey=MMKKAQKSFFEKJQ-UHFFFAOYSA-N
SMILES:N(C1=C(Cl)C=C(C(F)(F)F)C=N1)C2=CC=C(F)C=C2
Synonyms:- 2-Pyridinamine, 3-chloro-N-(4-fluorophenyl)-5-(trifluoromethyl)-
- 3-Chloro-N-(4-fluorophenyl)-5-(trifluoromethyl)-2-pyridinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.