CymitQuimica logo

CAS 1219976-71-2

:

Piperidine, 3-[(cyclopropylmethoxy)methyl]-, hydrochloride (1:1)

Description:
Piperidine, 3-[(cyclopropylmethoxy)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocyclic amine. The presence of a cyclopropylmethoxy group at the 3-position of the piperidine ring contributes to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The compound may exhibit properties such as basicity due to the nitrogen atom in the piperidine ring, which can participate in hydrogen bonding and interact with biological targets. Its structural features suggest potential uses in medicinal chemistry, possibly as a precursor or intermediate in the synthesis of more complex molecules. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Further studies would be necessary to fully elucidate its pharmacological profile and potential applications.
Formula:C10H19NO·ClH
InChI:InChI=1S/C10H19NO.ClH/c1-2-10(6-11-5-1)8-12-7-9-3-4-9;/h9-11H,1-8H2;1H
InChI key:InChIKey=GBFFCDMVDWXVNX-UHFFFAOYSA-N
SMILES:C(OCC1CCCNC1)C2CC2.Cl
Synonyms:
  • Piperidine, 3-[(cyclopropylmethoxy)methyl]-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.