CAS 1219976-77-8

Piperidine, 4-[(3-bromophenyl)methoxy]-, hydrochloride (1:1)

Description:

Piperidine, 4-[(3-bromophenyl)methoxy]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The presence of a 3-bromophenyl group attached via a methoxy linkage at the 4-position of the piperidine ring contributes to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, including medicinal chemistry. The bromine substituent may impart specific reactivity and biological activity, making it of interest in pharmaceutical research. This compound may exhibit properties such as basicity due to the nitrogen atom in the piperidine ring, and it can participate in various chemical reactions, including nucleophilic substitutions. Its structure suggests potential interactions with biological targets, which could be explored for therapeutic purposes. Safety and handling precautions should be observed, as with any chemical substance, particularly those with halogenated groups.

Formula: C₁₂H₁₆BrNO·ClH

InChI: InChI=1S/C12H16BrNO.ClH/c13-11-3-1-2-10(8-11)9-15-12-4-6-14-7-5-12;/h1-3,8,12,14H,4-7,9H2;1H

InChI key: InChIKey=JKLOTKDQLPHHFZ-UHFFFAOYSA-N

SMILES: C(OC1CCNCC1)C2=CC(Br)=CC=C2.Cl

Synonyms:

• Piperidine, 4-[(3-bromophenyl)methoxy]-, hydrochloride (1:1)