CymitQuimica logo

CAS 1219976-83-6

:

Acetamide, 2-amino-N-[(tetrahydro-2H-pyran-4-yl)methyl]-, hydrochloride (1:1)

Description:
Acetamide, 2-amino-N-[(tetrahydro-2H-pyran-4-yl)methyl]-, hydrochloride (1:1), identified by CAS number 1219976-83-6, is a chemical compound characterized by its amide functional group, which is indicative of its potential as a polar solvent and its ability to participate in hydrogen bonding. The presence of the tetrahydro-2H-pyran moiety suggests that the compound has a cyclic ether structure, contributing to its stability and solubility in various solvents. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, enhancing its utility in biological and pharmaceutical applications. The compound may exhibit biological activity due to the amino group, which can interact with various biological targets. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. However, specific properties such as melting point, boiling point, and reactivity would require empirical data for precise characterization.
Formula:C8H16N2O2·ClH
InChI:InChI=1S/C8H16N2O2.ClH/c9-5-8(11)10-6-7-1-3-12-4-2-7;/h7H,1-6,9H2,(H,10,11);1H
InChI key:InChIKey=ODHVKFFSBQHFNR-UHFFFAOYSA-N
SMILES:C(NC(CN)=O)C1CCOCC1.Cl
Synonyms:
  • Acetamide, 2-amino-N-[(tetrahydro-2H-pyran-4-yl)methyl]-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.