CymitQuimica logo

CAS 1219977-05-5

:

3-(4-Chloro-3,5-dimethylphenoxy)azetidine

Description:
3-(4-Chloro-3,5-dimethylphenoxy)azetidine is a chemical compound characterized by its azetidine ring, which is a four-membered saturated heterocyclic structure containing one nitrogen atom. The compound features a phenoxy group, specifically a 4-chloro-3,5-dimethylphenyl moiety, which contributes to its hydrophobic characteristics and potential biological activity. The presence of chlorine and methyl groups on the aromatic ring can influence the compound's reactivity, solubility, and interaction with biological targets. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique structural features. Additionally, the azetidine ring can impart strain, which may enhance reactivity in certain chemical reactions. Overall, 3-(4-Chloro-3,5-dimethylphenoxy)azetidine represents a class of compounds that may have applications in various fields, including drug discovery and agrochemicals, although specific biological activities and applications would require further investigation.
Formula:C11H14ClNO
InChI:InChI=1S/C11H14ClNO/c1-7-3-9(4-8(2)11(7)12)14-10-5-13-6-10/h3-4,10,13H,5-6H2,1-2H3
InChI key:InChIKey=YXJSSPAHYFNHCK-UHFFFAOYSA-N
SMILES:O(C1=CC(C)=C(Cl)C(C)=C1)C2CNC2
Synonyms:
  • 3-(4-Chloro-3,5-dimethylphenoxy)azetidine
  • Azetidine, 3-(4-chloro-3,5-dimethylphenoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.