CAS 1219977-21-5

Pyrrolidine, 3-(2-chloro-4-ethylphenoxy)-, hydrochloride (1:1)

Description:

Pyrrolidine, 3-(2-chloro-4-ethylphenoxy)-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine core, which is a five-membered saturated heterocyclic amine. The presence of a 2-chloro-4-ethylphenoxy group indicates that it has a phenolic structure with a chlorine substituent and an ethyl group, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The compound may exhibit biological activity due to its structural features, potentially interacting with biological targets. Its molecular structure suggests it could be involved in various chemical reactions, including nucleophilic substitutions or electrophilic additions. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or reactivity. Overall, this compound's characteristics make it of interest in medicinal chemistry and related fields.

Formula: C₁₂H₁₆ClNO·ClH

InChI: InChI=1S/C12H16ClNO.ClH/c1-2-9-3-4-12(11(13)7-9)15-10-5-6-14-8-10;/h3-4,7,10,14H,2,5-6,8H2,1H3;1H

InChI key: InChIKey=YTGFCBUWLBYFFD-UHFFFAOYSA-N

SMILES: O(C1=C(Cl)C=C(CC)C=C1)C2CCNC2.Cl

Synonyms:

• Pyrrolidine, 3-(2-chloro-4-ethylphenoxy)-, hydrochloride (1:1)