
CAS 1219977-23-7
:3-[(3,5-Dimethoxyphenyl)methyl]pyrrolidine
Description:
3-[(3,5-Dimethoxyphenyl)methyl]pyrrolidine is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a substituted phenyl group. The presence of two methoxy groups on the phenyl ring enhances its lipophilicity and may influence its biological activity. This compound is likely to exhibit properties typical of both amines and aromatic compounds, such as potential basicity due to the nitrogen atom in the pyrrolidine ring. The methoxy groups can also participate in various chemical reactions, including electrophilic aromatic substitution. Additionally, the compound may have implications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. Its CAS number, 1219977-23-7, allows for precise identification in chemical databases, facilitating research and application in various fields, including organic synthesis and drug discovery. Overall, the characteristics of this compound suggest it may possess interesting chemical and biological properties worthy of further investigation.
Formula:C13H19NO2
InChI:InChI=1S/C13H19NO2/c1-15-12-6-11(7-13(8-12)16-2)5-10-3-4-14-9-10/h6-8,10,14H,3-5,9H2,1-2H3
InChI key:InChIKey=GWUAELDIEVLACQ-UHFFFAOYSA-N
SMILES:C(C1=CC(OC)=CC(OC)=C1)C2CCNC2
Synonyms:- 3-[(3,5-Dimethoxyphenyl)methyl]pyrrolidine
- Pyrrolidine, 3-[(3,5-dimethoxyphenyl)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.