
CAS 1219977-25-9
:3-[4-(1-Methylpropyl)phenoxy]azetidine
Description:
3-[4-(1-Methylpropyl)phenoxy]azetidine, identified by its CAS number 1219977-25-9, is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. This compound features a phenoxy group, where a phenyl ring is bonded to an oxygen atom, and a branched alkyl substituent (1-methylpropyl) that enhances its hydrophobic characteristics. The presence of the azetidine ring contributes to its potential as a building block in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's unique structure may influence its biological activity, solubility, and interaction with biological targets. Additionally, the presence of the bulky 1-methylpropyl group can affect the steric and electronic properties, potentially impacting its reactivity and stability. While specific physical and chemical properties such as melting point, boiling point, and solubility are not provided, compounds of this nature are often investigated for their potential applications in drug design and synthesis.
Formula:C13H19NO
InChI:InChI=1S/C13H19NO/c1-3-10(2)11-4-6-12(7-5-11)15-13-8-14-9-13/h4-7,10,13-14H,3,8-9H2,1-2H3
InChI key:InChIKey=ONVURXYSERTJTJ-UHFFFAOYSA-N
SMILES:C(CC)(C)C1=CC=C(OC2CNC2)C=C1
Synonyms:- Azetidine, 3-[4-(1-methylpropyl)phenoxy]-
- 3-[4-(1-Methylpropyl)phenoxy]azetidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.