
CAS 1219977-28-2
:Pyrrolidine, 3-(2-chloro-4-methylphenoxy)-, hydrochloride (1:1)
Description:
Pyrrolidine, 3-(2-chloro-4-methylphenoxy)-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered saturated heterocycle containing one nitrogen atom. The presence of the 2-chloro-4-methylphenoxy group indicates that the compound has a phenolic moiety substituted with a chlorine atom and a methyl group, contributing to its unique chemical properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, particularly in pharmaceutical formulations. The compound may exhibit biological activity, potentially influencing neurotransmitter systems or other physiological pathways, making it of interest in medicinal chemistry. Its specific interactions, stability, and reactivity would depend on the functional groups present and the overall molecular structure. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.
Formula:C11H14ClNO·ClH
InChI:InChI=1S/C11H14ClNO.ClH/c1-8-2-3-11(10(12)6-8)14-9-4-5-13-7-9;/h2-3,6,9,13H,4-5,7H2,1H3;1H
InChI key:InChIKey=FXKXVAXSBVNWRG-UHFFFAOYSA-N
SMILES:O(C1=C(Cl)C=C(C)C=C1)C2CCNC2.Cl
Synonyms:- Pyrrolidine, 3-(2-chloro-4-methylphenoxy)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.