CAS 1219977-29-3
:3-(3-Methylbutyl)piperidine
Description:
3-(3-Methylbutyl)piperidine is an organic compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The structure features a 3-(3-methylbutyl) substituent, indicating that a branched alkyl group is attached to the third carbon of the piperidine ring. This compound is typically colorless to pale yellow in appearance and may possess a distinctive odor. It is soluble in organic solvents, reflecting its hydrophobic nature due to the alkyl chain. The presence of the nitrogen atom in the piperidine ring contributes to its basicity and potential reactivity, making it of interest in various chemical syntheses and applications, including pharmaceuticals and agrochemicals. The compound's molecular structure allows for interactions with biological systems, which may lead to specific pharmacological effects. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C10H21N
InChI:InChI=1S/C10H21N/c1-9(2)5-6-10-4-3-7-11-8-10/h9-11H,3-8H2,1-2H3
InChI key:InChIKey=YAHGEJCICHJXKP-UHFFFAOYSA-N
SMILES:C(CC(C)C)C1CCCNC1
Synonyms:- Piperidine, 3-(3-methylbutyl)-
- 3-(3-Methylbutyl)piperidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.