CAS 1219977-33-9

Piperidine, 3-[[(4-methoxyphenyl)methoxy]methyl]-, hydrochloride (1:1)

Description:

Piperidine, 3-[[(4-methoxyphenyl)methoxy]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. This compound features a methoxyphenyl group, indicating the presence of a methoxy group (-OCH3) attached to a phenyl ring, which is further linked to the piperidine via a methoxy methyl group. The hydrochloride designation indicates that the compound is in its salt form, typically enhancing its solubility in water and stability. This substance may exhibit properties typical of piperidine derivatives, such as potential biological activity, making it of interest in medicinal chemistry. Its molecular structure suggests it could interact with various biological targets, possibly influencing neurotransmitter systems or other physiological pathways. As with many piperidine derivatives, it may also possess applications in the synthesis of pharmaceuticals or agrochemicals. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₄H₂₁NO₂·ClH

InChI: InChI=1S/C14H21NO2.ClH/c1-16-14-6-4-12(5-7-14)10-17-11-13-3-2-8-15-9-13;/h4-7,13,15H,2-3,8-11H2,1H3;1H

InChI key: InChIKey=XLZSDBUKYRMXPZ-UHFFFAOYSA-N

SMILES: C(OCC1CCCNC1)C2=CC=C(OC)C=C2.Cl

Synonyms:

• Piperidine, 3-[[(4-methoxyphenyl)methoxy]methyl]-, hydrochloride (1:1)