CAS 1219977-34-0

3-(2-Methylbutyl)piperidine

Description:

3-(2-Methylbutyl)piperidine is an organic compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a 2-methylbutyl substituent at the third position of the piperidine ring contributes to its unique properties. This compound is typically a colorless to pale yellow liquid with a distinctive amine-like odor. It is soluble in organic solvents and exhibits moderate polarity due to the nitrogen atom in the ring. The piperidine structure imparts basicity to the compound, allowing it to participate in various chemical reactions, including nucleophilic substitutions and alkylation. Additionally, 3-(2-Methylbutyl)piperidine may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in the synthesis of more complex molecules or as a building block in organic synthesis. Safety data should be consulted for handling and exposure guidelines, as compounds with amine functionalities can pose health risks if not managed properly.

Formula: C₁₀H₂₁N

InChI: InChI=1S/C10H21N/c1-3-9(2)7-10-5-4-6-11-8-10/h9-11H,3-8H2,1-2H3

InChI key: InChIKey=RXLJWPBJOMNYEM-UHFFFAOYSA-N

SMILES: C(C(CC)C)C1CCCNC1

Synonyms:

• Piperidine, 3-(2-methylbutyl)-
• 3-(2-Methylbutyl)piperidine