CymitQuimica logo

CAS 1219977-38-4

:

Pyrazine, 2-chloro-6-(3-pyrrolidinyloxy)-, hydrochloride (1:1)

Description:
Pyrazine, 2-chloro-6-(3-pyrrolidinyloxy)-, hydrochloride (1:1) is a chemical compound characterized by its pyrazine core, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of a chlorine atom at the 2-position and a pyrrolidinyloxy group at the 6-position contributes to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water, enhancing its utility in various applications, particularly in pharmaceutical formulations. The compound may exhibit specific pharmacological effects, making it of interest in medicinal chemistry. Its structure suggests potential interactions with biological targets, which could be explored for therapeutic purposes. Safety and handling precautions are essential, as with any chemical, due to potential toxicity or reactivity. Overall, this compound represents a class of heterocyclic compounds that can be valuable in research and development within the fields of chemistry and pharmacology.
Formula:C8H10ClN3O·ClH
InChI:InChI=1S/C8H10ClN3O.ClH/c9-7-4-11-5-8(12-7)13-6-1-2-10-3-6;/h4-6,10H,1-3H2;1H
InChI key:InChIKey=KJRHSCGFSXIWHR-UHFFFAOYSA-N
SMILES:O(C1=NC(Cl)=CN=C1)C2CCNC2.Cl
Synonyms:
  • Pyrazine, 2-chloro-6-(3-pyrrolidinyloxy)-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.