
CAS 1219977-39-5
:Piperidine, 3-[[(3-bromophenyl)methoxy]methyl]-, hydrochloride (1:1)
Description:
Piperidine, 3-[[[3-bromophenyl)methoxy]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The presence of a 3-bromophenyl group and a methoxy methyl substituent contributes to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals. The compound may exhibit specific pharmacological effects due to its structural features, making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic purposes. Safety and handling precautions are essential, as with any chemical, particularly those with halogenated substituents, which may pose environmental and health risks. Overall, this compound represents a class of piperidine derivatives that could have significant implications in drug development and research.
Formula:C13H18BrNO·ClH
InChI:InChI=1S/C13H18BrNO.ClH/c14-13-5-1-3-11(7-13)9-16-10-12-4-2-6-15-8-12;/h1,3,5,7,12,15H,2,4,6,8-10H2;1H
InChI key:InChIKey=XZWKEPAVWAZVSP-UHFFFAOYSA-N
SMILES:C(OCC1CCCNC1)C2=CC(Br)=CC=C2.Cl
Synonyms:- Piperidine, 3-[[(3-bromophenyl)methoxy]methyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.