CAS 1219979-13-1
:Methanone, (2-amino-6-methoxyphenyl)(2-fluorophenyl)-
Description:
Methanone, (2-amino-6-methoxyphenyl)(2-fluorophenyl)-, also known by its CAS number 1219979-13-1, is an organic compound characterized by its unique structural features. It contains a methanone functional group, which is indicative of a ketone, and is substituted with an amino group and a methoxy group on a phenyl ring, as well as a fluorine atom on another phenyl ring. This compound exhibits properties typical of aromatic amines and ketones, including potential reactivity due to the presence of the amino group, which can participate in various chemical reactions such as nucleophilic substitutions. The methoxy group may influence the compound's solubility and electronic properties, while the fluorine atom can enhance its biological activity and lipophilicity. Such structural characteristics suggest that this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, where modifications to aromatic systems are common for optimizing biological activity. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require experimental determination or detailed literature references.
Formula:C14H12FNO2
InChI:InChI=1S/C14H12FNO2/c1-18-12-8-4-7-11(16)13(12)14(17)9-5-2-3-6-10(9)15/h2-8H,16H2,1H3
InChI key:InChIKey=LFUYWJFUAGHFFH-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(OC)C=CC=C1N)C2=C(F)C=CC=C2
Synonyms:- Methanone, (2-amino-6-methoxyphenyl)(2-fluorophenyl)-
- (2-Amino-6-methoxyphenyl)(2-fluorophenyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.