CAS 1219979-18-6

Piperidine, 4-[[(5-chloro[1,1′-biphenyl]-2-yl)oxy]methyl]-, hydrochloride (1:1)

Description:

Piperidine, 4-[[[5-chloro[1,1′-biphenyl]-2-yl]oxy]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocyclic amine. The presence of a chloro-substituted biphenyl moiety indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The hydrochloride salt form suggests enhanced solubility in water, making it suitable for various biological assays and formulations. This compound may exhibit properties typical of piperidine derivatives, such as acting as a base and participating in nucleophilic reactions. Its structure implies potential interactions with biological targets, which could be explored for therapeutic effects. As with many organic compounds, safety and handling precautions are essential, particularly due to the presence of chlorine, which can impart toxicity. Overall, this compound's unique structure and properties make it of interest in both synthetic and medicinal chemistry contexts.

Formula: C₁₈H₂₀ClNO·ClH

InChI: InChI=1S/C18H20ClNO.ClH/c19-16-6-7-18(21-13-14-8-10-20-11-9-14)17(12-16)15-4-2-1-3-5-15;/h1-7,12,14,20H,8-11,13H2;1H

InChI key: InChIKey=RNIGEJUGQLQLNA-UHFFFAOYSA-N

SMILES: O(CC1CCNCC1)C2=C(C=C(Cl)C=C2)C3=CC=CC=C3.Cl

Synonyms:

• Piperidine, 4-[[(5-chloro[1,1′-biphenyl]-2-yl)oxy]methyl]-, hydrochloride (1:1)