CAS 1219979-22-2

Piperidine, 2-[2-[2-bromo-4-(1,1-dimethylethyl)phenoxy]ethyl]-, hydrochloride (1:1)

Description:

Piperidine, 2-[2-[2-bromo-4-(1,1-dimethylethyl)phenoxy]ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The presence of a bromo substituent on the phenyl ring enhances its reactivity and potential for various chemical transformations. The compound features a phenoxy group, which contributes to its solubility and interaction with biological systems. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for pharmaceutical applications. The compound may exhibit biological activity, potentially acting as a ligand or modulator in various biochemical pathways. Its structural complexity suggests potential utility in medicinal chemistry, particularly in the development of therapeutic agents. However, specific biological properties, toxicity, and safety profiles would require further investigation through empirical studies.

Formula: C₁₇H₂₆BrNO·ClH

InChI: InChI=1S/C17H26BrNO.ClH/c1-17(2,3)13-7-8-16(15(18)12-13)20-11-9-14-6-4-5-10-19-14;/h7-8,12,14,19H,4-6,9-11H2,1-3H3;1H

InChI key: InChIKey=LUWZPUXHKIQUCG-UHFFFAOYSA-N

SMILES: O(CCC1CCCCN1)C2=C(Br)C=C(C(C)(C)C)C=C2.Cl

Synonyms:

• Piperidine, 2-[2-[2-bromo-4-(1,1-dimethylethyl)phenoxy]ethyl]-, hydrochloride (1:1)