CymitQuimica logo

CAS 1219979-23-3

:

Piperidine, 4-[[(3,5-difluorophenyl)methoxy]methyl]-, hydrochloride (1:1)

Description:
Piperidine, 4-[[(3,5-difluorophenyl)methoxy]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. The presence of the 3,5-difluorophenyl group indicates that the compound has two fluorine substituents on the aromatic ring, which can influence its electronic properties and reactivity. The methoxy group attached to the phenyl ring suggests that the compound may exhibit specific interactions due to the ether functionality. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. The compound may exhibit biological activity, potentially serving as a pharmacological agent, but specific biological properties would depend on further studies. Overall, its unique structure and functional groups contribute to its potential utility in medicinal chemistry and related fields.
Formula:C13H17F2NO·ClH
InChI:InChI=1S/C13H17F2NO.ClH/c14-12-5-11(6-13(15)7-12)9-17-8-10-1-3-16-4-2-10;/h5-7,10,16H,1-4,8-9H2;1H
InChI key:InChIKey=FDENUWPQMXDSDN-UHFFFAOYSA-N
SMILES:C(OCC1CCNCC1)C2=CC(F)=CC(F)=C2.Cl
Synonyms:
  • Piperidine, 4-[[(3,5-difluorophenyl)methoxy]methyl]-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.