CymitQuimica logo

CAS 1219979-26-6

:

4-Fluoro-N1-methyl-N1-[(tetrahydro-2H-pyran-4-yl)methyl]-1,2-benzenediamine

Description:
4-Fluoro-N1-methyl-N1-[(tetrahydro-2H-pyran-4-yl)methyl]-1,2-benzenediamine is a chemical compound characterized by its complex structure, which includes a fluorine atom, a methyl group, and a tetrahydro-2H-pyran moiety attached to a benzene ring with two amine functional groups. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility and reactivity. The presence of the fluorine atom may enhance lipophilicity and affect the compound's biological activity. Additionally, the tetrahydro-2H-pyran ring contributes to the compound's three-dimensional conformation, potentially impacting its interactions with biological targets. The compound's molecular weight, melting point, and boiling point would depend on its specific structural features and intermolecular forces. Overall, this compound may have applications in medicinal chemistry or as a building block in organic synthesis, although specific biological or pharmacological properties would require further investigation.
Formula:C13H19FN2O
InChI:InChI=1S/C13H19FN2O/c1-16(9-10-4-6-17-7-5-10)13-3-2-11(14)8-12(13)15/h2-3,8,10H,4-7,9,15H2,1H3
InChI key:InChIKey=OBCPYLBHLDHJJL-UHFFFAOYSA-N
SMILES:N(CC1CCOCC1)(C)C2=C(N)C=C(F)C=C2
Synonyms:
  • 4-Fluoro-N1-methyl-N1-[(tetrahydro-2H-pyran-4-yl)methyl]-1,2-benzenediamine
  • 1,2-Benzenediamine, 4-fluoro-N1-methyl-N1-[(tetrahydro-2H-pyran-4-yl)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.