CAS 1219979-29-9
:3-Amino-1-(3-hydroxy-1-azetidinyl)-1-propanone
Description:
3-Amino-1-(3-hydroxy-1-azetidinyl)-1-propanone is a chemical compound characterized by its unique structural features, including an amino group, a hydroxyl group, and a cyclic azetidine moiety. This compound is classified as an amino ketone due to the presence of both an amino group (-NH2) and a carbonyl group (C=O) within its structure. The azetidine ring contributes to its potential biological activity, as cyclic amines often exhibit interesting pharmacological properties. The hydroxyl group enhances the compound's solubility in polar solvents and may participate in hydrogen bonding, influencing its reactivity and interaction with biological targets. The presence of these functional groups suggests that 3-Amino-1-(3-hydroxy-1-azetidinyl)-1-propanone could be of interest in medicinal chemistry, particularly in the development of new therapeutic agents. Its specific properties, such as melting point, boiling point, and reactivity, would require empirical investigation to fully characterize its behavior in various chemical environments.
Formula:C6H12N2O2
InChI:InChI=1S/C6H12N2O2/c7-2-1-6(10)8-3-5(9)4-8/h5,9H,1-4,7H2
InChI key:InChIKey=CXWISQYTNLGJFY-UHFFFAOYSA-N
SMILES:C(CCN)(=O)N1CC(O)C1
Synonyms:- 3-Amino-1-(3-hydroxy-1-azetidinyl)-1-propanone
- 1-Propanone, 3-amino-1-(3-hydroxy-1-azetidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.