CAS 1219979-30-2

2-Chloro-N1-methyl-N1-[(tetrahydro-2H-pyran-4-yl)methyl]-1,4-benzenediamine

Description:

2-Chloro-N1-methyl-N1-[(tetrahydro-2H-pyran-4-yl)methyl]-1,4-benzenediamine is a chemical compound characterized by its complex structure, which includes a chloro substituent, a methyl group, and a tetrahydro-pyran moiety. This compound features a 1,4-benzenediamine backbone, indicating the presence of two amino groups attached to a benzene ring, which can influence its reactivity and potential applications in organic synthesis or medicinal chemistry. The chloro group introduces electrophilic characteristics, while the tetrahydro-pyran ring contributes to the compound's overall steric and electronic properties. The presence of the methyl group on the nitrogen atom can enhance lipophilicity, potentially affecting the compound's solubility and biological activity. This compound may exhibit interesting pharmacological properties, making it a candidate for further research in drug development. Its specific interactions and stability would depend on various factors, including pH, solvent, and temperature. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₃H₁₉ClN₂O

InChI: InChI=1S/C13H19ClN2O/c1-16(9-10-4-6-17-7-5-10)13-3-2-11(15)8-12(13)14/h2-3,8,10H,4-7,9,15H2,1H3

InChI key: InChIKey=XXXJLJYOIQWMBE-UHFFFAOYSA-N

SMILES: N(CC1CCOCC1)(C)C2=C(Cl)C=C(N)C=C2

Synonyms:

• 2-Chloro-N1-methyl-N1-[(tetrahydro-2H-pyran-4-yl)methyl]-1,4-benzenediamine
• 1,4-Benzenediamine, 2-chloro-N1-methyl-N1-[(tetrahydro-2H-pyran-4-yl)methyl]-