CAS 1219979-38-0

Piperidine, 4-[2-(1,1-dimethylethyl)-4-methylphenoxy]-, hydrochloride (1:1)

Description:

Piperidine, 4-[2-(1,1-dimethylethyl)-4-methylphenoxy]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocyclic amine. The presence of a 4-(2-(1,1-dimethylethyl)-4-methylphenoxy) substituent indicates that it has a bulky tert-butyl group and a methyl group on the aromatic ring, contributing to its hydrophobic properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The compound may exhibit biological activity, potentially acting as a ligand or modulator in biochemical pathways. Its structure suggests it could interact with various receptors or enzymes, making it of interest in medicinal chemistry. Safety data and handling precautions should be considered, as with any chemical substance, due to potential toxicity or reactivity. Overall, this compound's unique structural features may lead to specific pharmacological effects, warranting further investigation in drug development contexts.

Formula: C₁₆H₂₅NO·ClH

InChI: InChI=1S/C16H25NO.ClH/c1-12-5-6-15(14(11-12)16(2,3)4)18-13-7-9-17-10-8-13;/h5-6,11,13,17H,7-10H2,1-4H3;1H

InChI key: InChIKey=FQVCVSGWLFSDTF-UHFFFAOYSA-N

SMILES: O(C1=C(C(C)(C)C)C=C(C)C=C1)C2CCNCC2.Cl

Synonyms:

• Piperidine, 4-[2-(1,1-dimethylethyl)-4-methylphenoxy]-, hydrochloride (1:1)