CAS 1219979-41-5

Pyrrolidine, 3-[[4-chloro-2-(1-methylethyl)phenoxy]methyl]-, hydrochloride (1:1)

Description:

Pyrrolidine, 3-[[4-chloro-2-(1-methylethyl)phenoxy]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered saturated heterocyclic amine. The presence of a chloro-substituted phenoxy group contributes to its unique properties, potentially influencing its biological activity and solubility. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, which is advantageous for pharmaceutical applications. This compound may exhibit various pharmacological effects, making it of interest in medicinal chemistry. Its structure suggests potential interactions with biological targets, possibly influencing neurotransmitter systems or other cellular pathways. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or reactivity. Further studies would be necessary to elucidate its specific applications, mechanisms of action, and safety profile in biological systems.

Formula: C₁₄H₂₀ClNO·ClH

InChI: InChI=1S/C14H20ClNO.ClH/c1-10(2)13-7-12(15)3-4-14(13)17-9-11-5-6-16-8-11;/h3-4,7,10-11,16H,5-6,8-9H2,1-2H3;1H

InChI key: InChIKey=NZCZVJSELGHEDE-UHFFFAOYSA-N

SMILES: O(CC1CCNC1)C2=C(C(C)C)C=C(Cl)C=C2.Cl

Synonyms:

• Pyrrolidine, 3-[[4-chloro-2-(1-methylethyl)phenoxy]methyl]-, hydrochloride (1:1)