CymitQuimica logo

CAS 1219979-45-9

:

4-[2-(3-Piperidinyl)ethyl]morpholine

Description:
4-[2-(3-Piperidinyl)ethyl]morpholine, with the CAS number 1219979-45-9, is a chemical compound characterized by its unique structure that includes a morpholine ring and a piperidine moiety. This compound typically exhibits properties such as being a colorless to pale yellow liquid or solid, depending on its form and purity. It is soluble in polar solvents, which is common for amine-containing compounds due to their ability to form hydrogen bonds. The presence of both morpholine and piperidine groups suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as these structures are often associated with biological activity. Additionally, the compound may exhibit basic properties due to the nitrogen atoms in its structure, allowing it to participate in various chemical reactions, including alkylation and acylation. Safety data should be consulted for handling and storage, as compounds with amine functionalities can be sensitive to moisture and may require specific precautions.
Formula:C11H22N2O
InChI:InChI=1S/C11H22N2O/c1-2-11(10-12-4-1)3-5-13-6-8-14-9-7-13/h11-12H,1-10H2
InChI key:InChIKey=BYSFAURTJRJEHE-UHFFFAOYSA-N
SMILES:C(CN1CCOCC1)C2CCCNC2
Synonyms:
  • Morpholine, 4-[2-(3-piperidinyl)ethyl]-
  • 4-[2-(3-Piperidinyl)ethyl]morpholine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.