CymitQuimica logo

CAS 1219979-49-3

:

4-Pyridinecarboxylic acid, 2-(3-piperidinyl)ethyl ester, hydrochloride (1:1)

Description:
4-Pyridinecarboxylic acid, 2-(3-piperidinyl)ethyl ester, hydrochloride (1:1) is a chemical compound characterized by its pyridine and piperidine moieties, which contribute to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The presence of the pyridine ring suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The ester functional group indicates that it may undergo hydrolysis, which can affect its stability and bioavailability. Additionally, the piperidine ring can influence the compound's pharmacokinetic properties, such as absorption and distribution. This compound may exhibit various properties, including acidity, basicity, and lipophilicity, which are crucial for its interaction with biological systems. Overall, its structural features suggest that it could be investigated for therapeutic applications, although specific biological activities would need to be determined through empirical studies.
Formula:C13H18N2O2·ClH
InChI:InChI=1S/C13H18N2O2.ClH/c16-13(12-3-7-14-8-4-12)17-9-5-11-2-1-6-15-10-11;/h3-4,7-8,11,15H,1-2,5-6,9-10H2;1H
InChI key:InChIKey=VECHWZASFVLTME-UHFFFAOYSA-N
SMILES:C(OCCC1CCCNC1)(=O)C=2C=CN=CC2.Cl
Synonyms:
  • 4-Pyridinecarboxylic acid, 2-(3-piperidinyl)ethyl ester, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.