CAS 1219979-56-2

Acetic acid, 2,2,2-trichloro-, 2-(3-piperidinyl)ethyl ester, hydrochloride (1:1)

Description:

Acetic acid, 2,2,2-trichloro-, 2-(3-piperidinyl)ethyl ester, hydrochloride (1:1), identified by CAS number 1219979-56-2, is a chemical compound characterized by its ester functional group and the presence of a piperidine moiety. This compound features a trichloroacetyl group, which contributes to its reactivity and potential biological activity. The hydrochloride form indicates that it is a salt, enhancing its solubility in water and making it suitable for various applications, including pharmaceutical formulations. The piperidine ring suggests potential interactions with biological systems, possibly influencing its pharmacological properties. The presence of chlorine atoms may also impart unique characteristics, such as increased lipophilicity or altered metabolic pathways. Overall, this compound's structure suggests it may have applications in medicinal chemistry, particularly in the development of therapeutic agents, although specific biological activities would require further investigation. Safety and handling precautions should be observed due to the presence of chlorine and the potential for toxicity associated with similar compounds.

Formula: C₉H₁₄Cl₃NO₂·ClH

InChI: InChI=1S/C9H14Cl3NO2.ClH/c10-9(11,12)8(14)15-5-3-7-2-1-4-13-6-7;/h7,13H,1-6H2;1H

InChI key: InChIKey=AEDOUJSISSPZQP-UHFFFAOYSA-N

SMILES: C(COC(C(Cl)(Cl)Cl)=O)C1CCCNC1.Cl

Synonyms:

• Acetic acid, 2,2,2-trichloro-, 2-(3-piperidinyl)ethyl ester, hydrochloride (1:1)