CAS 1219979-63-1
:3-Azetidinyl 4-chloro-2-pyridinecarboxylate
Description:
3-Azetidinyl 4-chloro-2-pyridinecarboxylate is a chemical compound characterized by its unique structural features, which include an azetidine ring and a pyridinecarboxylate moiety. The presence of the azetidine ring, a four-membered saturated heterocycle, contributes to its potential biological activity and reactivity. The 4-chloro substituent on the pyridine ring enhances its electrophilic properties, making it a candidate for various chemical reactions. This compound may exhibit interesting pharmacological properties due to its structural components, which can interact with biological targets. Additionally, the carboxylate group can participate in hydrogen bonding and ionic interactions, influencing its solubility and stability in different environments. The compound's molecular weight, solubility, and specific reactivity would depend on its precise molecular structure and the conditions under which it is studied. Overall, 3-Azetidinyl 4-chloro-2-pyridinecarboxylate represents a class of compounds that may have applications in medicinal chemistry and drug development.
Formula:C9H9ClN2O2
InChI:InChI=1S/C9H9ClN2O2/c10-6-1-2-12-8(3-6)9(13)14-7-4-11-5-7/h1-3,7,11H,4-5H2
InChI key:InChIKey=ZUFJCSTWTJSLIJ-UHFFFAOYSA-N
SMILES:C(OC1CNC1)(=O)C2=CC(Cl)=CC=N2
Synonyms:- 2-Pyridinecarboxylic acid, 4-chloro-, 3-azetidinyl ester
- 3-Azetidinyl 4-chloro-2-pyridinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.