CAS 1219979-75-5
:N1,N1-Di-2-propen-1-yl-4-(trifluoromethyl)-1,2-benzenediamine
Description:
N1,N1-Di-2-propen-1-yl-4-(trifluoromethyl)-1,2-benzenediamine, identified by its CAS number 1219979-75-5, is an organic compound characterized by its unique molecular structure, which includes a benzene ring substituted with two propenyl groups and a trifluoromethyl group. This compound features two amino groups, which contribute to its potential reactivity and ability to form hydrogen bonds. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its electronic properties, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The propenyl substituents can participate in polymerization reactions, suggesting potential utility in materials science. Additionally, the compound's fluorinated nature may impart unique characteristics such as increased stability and altered solubility compared to non-fluorinated analogs. Overall, N1,N1-Di-2-propen-1-yl-4-(trifluoromethyl)-1,2-benzenediamine is a compound of interest for further research and development in multiple fields of chemistry.
Formula:C13H15F3N2
InChI:InChI=1S/C13H15F3N2/c1-3-7-18(8-4-2)12-6-5-10(9-11(12)17)13(14,15)16/h3-6,9H,1-2,7-8,17H2
InChI key:InChIKey=LSYKHRALRARPJB-UHFFFAOYSA-N
SMILES:N(CC=C)(CC=C)C1=C(N)C=C(C(F)(F)F)C=C1
Synonyms:- N1,N1-Di-2-propen-1-yl-4-(trifluoromethyl)-1,2-benzenediamine
- 1,2-Benzenediamine, N1,N1-di-2-propen-1-yl-4-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.