CAS 1219979-85-7

Propanoic acid, 2-methyl-, 3-piperidinylmethyl ester, hydrochloride (1:1)

Description:

Propanoic acid, 2-methyl-, 3-piperidinylmethyl ester, hydrochloride (1:1) is a chemical compound characterized by its ester functional group derived from propanoic acid and a piperidine moiety. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. The piperidine ring contributes to its potential biological activity, making it of interest in pharmaceutical applications. The presence of the methyl group on the propanoic acid backbone may influence its lipophilicity and overall pharmacokinetic properties. As a hydrochloride salt, it is often more stable and easier to handle than its free acid counterpart. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity. Overall, this compound's unique structure suggests potential utility in medicinal chemistry and related fields.

Formula: C₁₀H₁₉NO₂·ClH

InChI: InChI=1S/C10H19NO2.ClH/c1-8(2)10(12)13-7-9-4-3-5-11-6-9;/h8-9,11H,3-7H2,1-2H3;1H

InChI key: InChIKey=NBLFTMKRWXXDNQ-UHFFFAOYSA-N

SMILES: C(OC(C(C)C)=O)C1CCCNC1.Cl

Synonyms:

• Propanoic acid, 2-methyl-, 3-piperidinylmethyl ester, hydrochloride (1:1)